EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20ClNO5 |
| Net Charge | 0 |
| Average Mass | 401.846 |
| Monoisotopic Mass | 401.10300 |
| SMILES | CN1CC[C@H](c2c(O)cc(O)c3c(=O)cc(-c4ccccc4Cl)oc23)[C@H](O)C1 |
| InChI | InChI=1S/C21H20ClNO5/c1-23-7-6-12(17(27)10-23)19-14(24)8-15(25)20-16(26)9-18(28-21(19)20)11-4-2-3-5-13(11)22/h2-5,8-9,12,17,24-25,27H,6-7,10H2,1H3/t12-,17+/m0/s1 |
| InChIKey | BIIVYFLTOXDAOV-YVEFUNNKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alvocidib (CHEBI:47344) has role antineoplastic agent (CHEBI:35610) |
| alvocidib (CHEBI:47344) has role antirheumatic drug (CHEBI:35842) |
| alvocidib (CHEBI:47344) has role apoptosis inducer (CHEBI:68495) |
| alvocidib (CHEBI:47344) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| alvocidib (CHEBI:47344) is a dihydroxyflavone (CHEBI:38686) |
| alvocidib (CHEBI:47344) is a hydroxypiperidine (CHEBI:48590) |
| alvocidib (CHEBI:47344) is a monochlorobenzenes (CHEBI:83403) |
| alvocidib (CHEBI:47344) is a tertiary amino compound (CHEBI:50996) |
| alvocidib (CHEBI:47344) is conjugate base of alvocidib(1+) (CHEBI:90997) |
| Incoming Relation(s) |
| alvocidib(1+) (CHEBI:90997) is conjugate acid of alvocidib (CHEBI:47344) |
| IUPAC Name |
|---|
| 2-(2-chlorophenyl)-5,7-dihydroxy-8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]-4H-chromen-4-one |
| INNs | Source |
|---|---|
| alvocidib | WHO MedNet |
| alvocidib | WHO MedNet |
| alvocidib | WHO MedNet |
| alvocidibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| Flavopiridol | ChemIDplus |
| HMR 1274 | ChemIDplus |
| HMR-1274 | ChEBI |
| (−)-cis-5,7-dihydroxy-2-(2-chlorophenyl)-8-(4-(3-hydroxy-1-methyl)piperidinyl)-4H-1-benzopyran-4-one | ChemIDplus |
| L 86-8275 | ChemIDplus |
| L 868275 | ChemIDplus |
| Citations |
|---|