EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:47325 - α-N-dichloroacetyl-p-aminophenylserinol
| Formula | C11H14Cl2N2O3 |
| Net Charge | 0 |
| Average Mass | 293.150 |
| Monoisotopic Mass | 292.03815 |
| SMILES | Nc1ccc([C@@H](O)[C@@H](CO)NC(=O)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C11H14Cl2N2O3/c12-10(13)11(18)15-8(5-16)9(17)6-1-3-7(14)4-2-6/h1-4,8-10,16-17H,5,14H2,(H,15,18)/t8-,9-/m1/s1 |
| InChIKey | BFLNGKUCFYKCFZ-RKDXNWHRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-N-dichloroacetyl-p-aminophenylserinol (CHEBI:47325) has role prodrug (CHEBI:50266) |
| α-N-dichloroacetyl-p-aminophenylserinol (CHEBI:47325) is a diol (CHEBI:23824) |
| α-N-dichloroacetyl-p-aminophenylserinol (CHEBI:47325) is a organochlorine compound (CHEBI:36683) |
| α-N-dichloroacetyl-p-aminophenylserinol (CHEBI:47325) is a secondary carboxamide (CHEBI:140325) |
| α-N-dichloroacetyl-p-aminophenylserinol (CHEBI:47325) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| N-[(1R,2R)-1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]-2,2-dichloroacetamide |
| Synonyms | Source |
|---|---|
| N-[(1R,2R)-2-(4-aminophenyl)-2-hydroxy-1-(hydroxymethyl)ethyl]-2,2-dichloroacetamide | PDBeChem |
| α-N-dichloroacetyl-p-aminophenylserinol | PDBeChem |
| (1R,2R)-1-(4-aminophenyl)-2-(dichloroacetylamino)-1,3-propanediol | ChEBI |
| UniProt Name | Source |
|---|---|
| α-N-dichloroacetyl-p-aminophenylserinol | UniProt |
| Citations |
|---|