EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13BrN2O5 |
| Net Charge | 0 |
| Average Mass | 333.138 |
| Monoisotopic Mass | 332.00078 |
| SMILES | O=c1nc(=O)n([C@H]2C[C@H](O)[C@@H](CO)O2)cc1/C=C/Br |
| InChI | InChI=1S/C11H13BrN2O5/c12-2-1-6-4-14(11(18)13-10(6)17)9-3-7(16)8(5-15)19-9/h1-2,4,7-9,15-16H,3,5H2,(H,13,17,18)/b2-1+/t7-,8+,9+/m0/s1 |
| InChIKey | ODZBBRURCPAEIQ-PIXDULNESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. chemosensitiser Any compound that can sensitise tumour cells to chemotherapy. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brivudine (CHEBI:47278) has role antiviral drug (CHEBI:36044) |
| brivudine (CHEBI:47278) has role apoptosis inducer (CHEBI:68495) |
| brivudine (CHEBI:47278) has role chemosensitiser (CHEBI:233442) |
| brivudine (CHEBI:47278) is a organobromine compound (CHEBI:37141) |
| brivudine (CHEBI:47278) is a pyrimidine 2'-deoxyribonucleoside (CHEBI:19255) |
| IUPAC Name |
|---|
| 5-[(E)-2-bromoethenyl]-2'-deoxyuridine |
| INNs | Source |
|---|---|
| brivudina | WHO MedNet |
| brivudine | WHO MedNet |
| brivudine | WHO MedNet |
| brivudinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5-[(1E)-2-bromoethenyl]-2'-deoxyuridine | ChEBI |
| 5-bromovinyldeoxyuridine | PDBeChem |
| 5-[(E)-2-bromoethenyl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione | ChEBI |
| 5-[(E)-2-bromoethenyl]-2'-deoxyuridine | ChEBI |
| brivudin | DrugCentral |
| bromovinyldeoxyuridine | DrugCentral |
| Brand Names | Source |
|---|---|
| Brivir | DrugBank |
| Mevir | DrugBank |
| Zostex | KEGG DRUG |
| Citations |
|---|