EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13BrN2O5 |
| Net Charge | 0 |
| Average Mass | 333.138 |
| Monoisotopic Mass | 332.00078 |
| SMILES | O=c1nc(=O)n([C@H]2C[C@H](O)[C@@H](CO)O2)cc1/C=C/Br |
| InChI | InChI=1S/C11H13BrN2O5/c12-2-1-6-4-14(11(18)13-10(6)17)9-3-7(16)8(5-15)19-9/h1-2,4,7-9,15-16H,3,5H2,(H,13,17,18)/b2-1+/t7-,8+,9+/m0/s1 |
| InChIKey | ODZBBRURCPAEIQ-PIXDULNESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. chemosensitiser Any compound that can sensitise tumour cells to chemotherapy. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brivudine (CHEBI:47278) has role antiviral drug (CHEBI:36044) |
| brivudine (CHEBI:47278) has role apoptosis inducer (CHEBI:68495) |
| brivudine (CHEBI:47278) has role chemosensitiser (CHEBI:233442) |
| brivudine (CHEBI:47278) is a organobromine compound (CHEBI:37141) |
| brivudine (CHEBI:47278) is a pyrimidine 2'-deoxyribonucleoside (CHEBI:19255) |
| IUPAC Name |
|---|
| 5-[(E)-2-bromoethenyl]-2'-deoxyuridine |
| INNs | Source |
|---|---|
| brivudina | WHO MedNet |
| brivudine | WHO MedNet |
| brivudine | WHO MedNet |
| brivudinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5-[(1E)-2-bromoethenyl]-2'-deoxyuridine | ChEBI |
| 5-bromovinyldeoxyuridine | PDBeChem |
| 5-[(E)-2-bromoethenyl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione | ChEBI |
| 5-[(E)-2-bromoethenyl]-2'-deoxyuridine | ChEBI |
| brivudin | DrugCentral |
| bromovinyldeoxyuridine | DrugCentral |
| Brand Names | Source |
|---|---|
| Brivir | DrugBank |
| Mevir | DrugBank |
| Zostex | KEGG DRUG |
| Citations |
|---|