EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13BrN2O5 |
| Net Charge | 0 |
| Average Mass | 333.138 |
| Monoisotopic Mass | 332.00078 |
| SMILES | O=c1nc(=O)n([C@H]2C[C@H](O)[C@@H](CO)O2)cc1/C=C/Br |
| InChI | InChI=1S/C11H13BrN2O5/c12-2-1-6-4-14(11(18)13-10(6)17)9-3-7(16)8(5-15)19-9/h1-2,4,7-9,15-16H,3,5H2,(H,13,17,18)/b2-1+/t7-,8+,9+/m0/s1 |
| InChIKey | ODZBBRURCPAEIQ-PIXDULNESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. antiviral agent A substance that destroys or inhibits replication of viruses. chemosensitiser Any compound that can sensitise tumour cells to chemotherapy. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brivudine (CHEBI:47278) has role antineoplastic agent (CHEBI:35610) |
| brivudine (CHEBI:47278) has role antiviral agent (CHEBI:22587) |
| brivudine (CHEBI:47278) has role antiviral drug (CHEBI:36044) |
| brivudine (CHEBI:47278) has role apoptosis inducer (CHEBI:68495) |
| brivudine (CHEBI:47278) has role chemosensitiser (CHEBI:233442) |
| brivudine (CHEBI:47278) is a organobromine compound (CHEBI:37141) |
| brivudine (CHEBI:47278) is a pyrimidine 2'-deoxyribonucleoside (CHEBI:19255) |
| IUPAC Name |
|---|
| 5-[(E)-2-bromoethenyl]-2'-deoxyuridine |
| INNs | Source |
|---|---|
| brivudina | WHO MedNet |
| brivudine | WHO MedNet |
| brivudine | WHO MedNet |
| brivudinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5-[(1E)-2-bromoethenyl]-2'-deoxyuridine | ChEBI |
| 5-bromovinyldeoxyuridine | PDBeChem |
| 5-[(E)-2-bromoethenyl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione | ChEBI |
| 5-[(E)-2-bromoethenyl]-2'-deoxyuridine | ChEBI |
| brivudin | DrugCentral |
| bromovinyldeoxyuridine | DrugCentral |
| Brand Names | Source |
|---|---|
| Brivir | DrugBank |
| Mevir | DrugBank |
| Zostex | KEGG DRUG |
| Citations |
|---|