EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15N5O7S2 |
| Net Charge | 0 |
| Average Mass | 453.458 |
| Monoisotopic Mass | 453.04129 |
| SMILES | [H][C@]12SCC(C=C)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)/C(=N\OCC(=O)O)c1csc(N)n1 |
| InChI | InChI=1S/C16H15N5O7S2/c1-2-6-4-29-14-10(13(25)21(14)11(6)15(26)27)19-12(24)9(20-28-3-8(22)23)7-5-30-16(17)18-7/h2,5,10,14H,1,3-4H2,(H2,17,18)(H,19,24)(H,22,23)(H,26,27)/b20-9-/t10-,14-/m1/s1 |
| InChIKey | OKBVVJOGVLARMR-QSWIMTSFSA-N |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefixime (CHEBI:472657) has role antibacterial drug (CHEBI:36047) |
| cefixime (CHEBI:472657) has role drug allergen (CHEBI:88188) |
| cefixime (CHEBI:472657) is a cephalosporin (CHEBI:23066) |
| IUPAC Name |
|---|
| 7β-{(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[(carboxymethoxy)imino]acetamido}-3-ethenyl-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefixima | ChemIDplus |
| cefixime | ChemIDplus |
| cefiximum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (6R,7R)-7-({(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[(carboxymethoxy)imino]acetyl}amino)-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| (−)-cefixim | ChemIDplus |
| Citations |
|---|