EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11BrN2O5 |
| Net Charge | 0 |
| Average Mass | 307.100 |
| Monoisotopic Mass | 305.98513 |
| SMILES | O=c1nc(=O)n([C@H]2C[C@H](O)[C@@H](CO)O2)cc1Br |
| InChI | InChI=1S/C9H11BrN2O5/c10-4-2-12(9(16)11-8(4)15)7-1-5(14)6(3-13)17-7/h2,5-7,13-14H,1,3H2,(H,11,15,16)/t5-,6+,7+/m0/s1 |
| InChIKey | WOVKYSAHUYNSMH-RRKCRQDMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-bromo-2'-deoxyuridine (CHEBI:472552) has role antimetabolite (CHEBI:35221) |
| 5-bromo-2'-deoxyuridine (CHEBI:472552) has role antineoplastic agent (CHEBI:35610) |
| 5-bromo-2'-deoxyuridine (CHEBI:472552) is a pyrimidine 2'-deoxyribonucleoside (CHEBI:19255) |
| IUPAC Name |
|---|
| 5-bromo-2'-deoxyuridine |
| INNs | Source |
|---|---|
| broxuridine | ChemIDplus |
| broxuridina | ChemIDplus |
| broxuridinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Bromodeoxyuridine | ChemIDplus |
| 5-Bromodeoxyuridine | ChemIDplus |
| 5-Bdu | ChemIDplus |
| 5-Bromodesoxyuridine | ChemIDplus |
| 5-Bromouracil deoxyriboside | ChemIDplus |
| 5-Bromouracil-2-deoxyriboside | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| U33 | PDBeChem |
| Bromodeoxyuridine | Wikipedia |
| 3042 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4236087 | Beilstein |
| CAS:59-14-3 | ChemIDplus |
| Citations |
|---|