EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27N5O7S |
| Net Charge | 0 |
| Average Mass | 517.564 |
| Monoisotopic Mass | 517.16312 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)[C@H](NC(=O)N1CCN(CC)C(=O)C1=O)c1ccccc1 |
| InChI | InChI=1S/C23H27N5O7S/c1-4-26-10-11-27(19(32)18(26)31)22(35)25-13(12-8-6-5-7-9-12)16(29)24-14-17(30)28-15(21(33)34)23(2,3)36-20(14)28/h5-9,13-15,20H,4,10-11H2,1-3H3,(H,24,29)(H,25,35)(H,33,34)/t13-,14-,15+,20-/m1/s1 |
| InChIKey | IVBHGBMCVLDMKU-GXNBUGAJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piperacillin (CHEBI:8232) has role antibacterial drug (CHEBI:36047) |
| piperacillin (CHEBI:8232) is a penicillin (CHEBI:17334) |
| piperacillin (CHEBI:8232) is a penicillin allergen (CHEBI:88187) |
| piperacillin (CHEBI:8232) is conjugate acid of piperacillin(1−) (CHEBI:52433) |
| Incoming Relation(s) |
| piperacilloyl-L-lysine (CHEBI:139364) has functional parent piperacillin (CHEBI:8232) |
| piperacillin(1−) (CHEBI:52433) is conjugate base of piperacillin (CHEBI:8232) |
| piperacilloyl group (CHEBI:139370) is substituent group from piperacillin (CHEBI:8232) |
| IUPAC Name |
|---|
| 6β-{(2R)-2-[(4-ethyl-2,3-dioxopiperazin-1-yl)carboxamido]-2-phenylacetamido}-2,2-dimethylpenam-3α-carboxylic acid |
| INN | Source |
|---|---|
| piperacillin | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (2S,5R,6R)-6-{[(2R)-2-{[(4-ethyl-2,3-dioxopiperazin-1-yl)carbonyl]amino}-2-phenylacetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | IUPAC |
| Piperacillin | KEGG COMPOUND |
| Piperacillin anhydrous | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6081140 | Reaxys |
| CAS:61477-96-1 | KEGG COMPOUND |
| CAS:61477-96-1 | ChemIDplus |
| Citations |
|---|