EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22FN3O2 |
| Net Charge | 0 |
| Average Mass | 379.435 |
| Monoisotopic Mass | 379.16961 |
| SMILES | O=C(CCCN1CC=C(n2c(=O)nc3ccccc32)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H22FN3O2/c23-17-9-7-16(8-10-17)21(27)6-3-13-25-14-11-18(12-15-25)26-20-5-2-1-4-19(20)24-22(26)28/h1-2,4-5,7-11H,3,6,12-15H2,(H,24,28) |
| InChIKey | RMEDXOLNCUSCGS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | anaesthesia adjuvant Any substance that possesses little anaesthetic effect by itself, but which enhances or potentiates the anaesthetic action of other drugs when given at the same time. first generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be more likely than second generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements; such body movements can become permanent even after treatment has ceased. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| droperidol (CHEBI:4717) has role anaesthesia adjuvant (CHEBI:60807) |
| droperidol (CHEBI:4717) has role antiemetic (CHEBI:50919) |
| droperidol (CHEBI:4717) has role dopaminergic antagonist (CHEBI:48561) |
| droperidol (CHEBI:4717) has role first generation antipsychotic (CHEBI:65190) |
| droperidol (CHEBI:4717) is a aromatic ketone (CHEBI:76224) |
| droperidol (CHEBI:4717) is a benzimidazoles (CHEBI:22715) |
| droperidol (CHEBI:4717) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 1-{1-[4-(4-fluorophenyl)-4-oxobutyl]-1,2,3,6-tetrahydropyridin-4-yl}-1,3-dihydro-2H-benzimidazol-2-one |
| INNs | Source |
|---|---|
| droperidol | ChemIDplus |
| droperidolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-{1-[4-(4-Fluoro-phenyl)-4-oxo-butyl]-1,2,3,6-tetrahydro-pyridin-4-yl}-1,3-dihydro-benzoimidazol-2-one | ChEMBL |
| 1-{1-[4-(4-fluorophenyl)-4-oxobutyl]-1,2,3,6-tetrahydro-4-pyridinyl}-2,3-dihydro-1H-benzo[d]imidazol-2-one | ChEMBL |
| 1-(1-(4-(p-fluorophenyl)-4-oxobutyl)-1,2,3,6-tetrahydro-4-pyridyl)-2-benzimidazolinone | ChemIDplus |
| 1-(1-(3-(p-fluorobenzoyl)propyl)-1,2,3,6-tetrahydro-4-pyridyl)-2-benzimidazolinone | ChemIDplus |