EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4714 - dracorubin
| Formula | C32H24O5 |
| Net Charge | 0 |
| Average Mass | 488.539 |
| Monoisotopic Mass | 488.16237 |
| SMILES | COc1cc2oc3c(C)c(=O)cc4oc(-c5ccccc5)cc(c2c2c1CC[C@@H](c1ccccc1)O2)c43 |
| InChI | InChI=1S/C32H24O5/c1-18-23(33)16-27-29-22(15-25(35-27)20-11-7-4-8-12-20)30-28(37-31(18)29)17-26(34-2)21-13-14-24(36-32(21)30)19-9-5-3-6-10-19/h3-12,15-17,24H,13-14H2,1-2H3/t24-/m0/s1 |
| InChIKey | FWKBXSPDFCAHFN-DEOSSOPVSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dracorubin (CHEBI:4714) has role plant metabolite (CHEBI:76924) |
| dracorubin (CHEBI:4714) is a aromatic ether (CHEBI:35618) |
| dracorubin (CHEBI:4714) is a proanthocyanidin (CHEBI:26267) |
| IUPAC Name |
|---|
| (2S)-5-methoxy-8-methyl-2,12-diphenyl-3,4-dihydro-2H,9H-dipyrano[2,3-a:2',3',4'-kl]xanthen-9-one |