EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44O2 |
| Net Charge | 0 |
| Average Mass | 412.658 |
| Monoisotopic Mass | 412.33413 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/[C@H](C)C(C)C)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)C[C@H](O)C1=C |
| InChI | InChI=1S/C28H44O2/c1-18(2)19(3)9-10-20(4)25-13-14-26-22(8-7-15-28(25,26)6)11-12-23-16-24(29)17-27(30)21(23)5/h9-12,18-20,24-27,29-30H,5,7-8,13-17H2,1-4,6H3/b10-9+,22-11+,23-12-/t19-,20+,24+,25+,26-,27-,28+/m0/s1 |
| InChIKey | HKXBNHCUPKIYDM-CGMHZMFXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | provitamin A substance that can be converted into a vitamin by animal tissues. prohormone Any intra-glandular substance that acts as a precursor of a hormone, usually having minimal hormonal effect itself. Prohormones generally help in amplifying the effect of existing hormones. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| Application: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| doxercalciferol (CHEBI:4712) has role bone density conservation agent (CHEBI:50646) |
| doxercalciferol (CHEBI:4712) has role prohormone (CHEBI:71212) |
| doxercalciferol (CHEBI:4712) has role provitamin (CHEBI:50188) |
| doxercalciferol (CHEBI:4712) is a hydroxy seco-steroid (CHEBI:36853) |
| doxercalciferol (CHEBI:4712) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (1S,3R,5Z,7E,22E)-9,10-secoergosta-5,7,10,22-tetraene-1,3-diol |
| INNs | Source |
|---|---|
| doxercalciferol | WHO MedNet |
| doxercalciferol | ChemIDplus |
| doxercalciferolum | WHO MedNet |
| doxercalciférolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1α-hydroxyergocalciferol | ChemIDplus |
| 1α-hydroxyvitamin D2 | ChEBI |
| Brand Name | Source |
|---|---|
| Hectorol | KEGG DRUG |
| UniProt Name | Source |
|---|---|
| 1α-hydroxyvitamin D2 | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:54573-75-0 | ChemIDplus |
| CAS:54573-75-0 | KEGG COMPOUND |
| Citations |
|---|