EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10BrNO2 |
| Net Charge | 0 |
| Average Mass | 244.088 |
| Monoisotopic Mass | 242.98949 |
| SMILES | N[C@@H](Cc1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C9H10BrNO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | PEMUHKUIQHFMTH-QMMMGPOBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-bromo-L-phenylalanine (CHEBI:47118) is a L-phenylalanine derivative (CHEBI:84144) |
| 4-bromo-L-phenylalanine (CHEBI:47118) is a 4-bromophenylalanine (CHEBI:233009) |
| 4-bromo-L-phenylalanine (CHEBI:47118) is enantiomer of 4-bromo-D-phenylalanine (CHEBI:233008) |
| Incoming Relation(s) |
| 4-bromo-DL-phenylalanine (CHEBI:166660) has part 4-bromo-L-phenylalanine (CHEBI:47118) |
| 4-bromo-D-phenylalanine (CHEBI:233008) is enantiomer of 4-bromo-L-phenylalanine (CHEBI:47118) |
| IUPAC Name |
|---|
| 4-bromo-L-phenylalanine |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-(4-bromophenyl)propanoic acid | IUPAC |
| (S)-2-amino-3-(4-bromophenyl)propanoic acid | ChEBI |
| L-4-bromophenylalanine | ChEBI |
| p-bromo-L-phenylalanine | ChEBI |
| 4-bromo-L-Phe-OH | ChEBI |
| p-bromo-L-Phe | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4BF | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:24250-84-8 | ChEBI |
| Citations |
|---|