EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C23H25N5O5.CH3O3S |
| Net Charge | 0 |
| Average Mass | 547.590 |
| Monoisotopic Mass | 547.17368 |
| SMILES | COc1cc2nc(N3CCN(C(=O)C4COc5ccccc5O4)CC3)nc(N)c2cc1OC.CS(=O)(=O)[O-].[H+] |
| InChI | InChI=1S/C23H25N5O5.CH4O3S/c1-30-18-11-14-15(12-19(18)31-2)25-23(26-21(14)24)28-9-7-27(8-10-28)22(29)20-13-32-16-5-3-4-6-17(16)33-20;1-5(2,3)4/h3-6,11-12,20H,7-10,13H2,1-2H3,(H2,24,25,26);1H3,(H,2,3,4) |
| InChIKey | VJECBOKJABCYMF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| doxazosin mesylate (CHEBI:4709) has part doxazosin (CHEBI:4708) |
| doxazosin mesylate (CHEBI:4709) has role geroprotector (CHEBI:176497) |
| doxazosin mesylate (CHEBI:4709) is a methanesulfonate salt (CHEBI:38037) |
| IUPAC Name |
|---|
| 2-[4-(2,3-dihydro-1,4-benzodioxin-2-ylcarbonyl)piperazin-1-yl]-6,7-dimethoxyquinazolin-4-amine methanesulfonate |
| Synonym | Source |
|---|---|
| 1-(4-Amino-6,7-dimethoxy-2-quinazolinyl)-4-(1,4-benzodioxan-2-ylcarbonyl)piperazine monomethanesulfonate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DBSALT001948 | DrugBank |
| D00608 | KEGG DRUG |
| 56686 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:77883-43-3 | ChemIDplus |
| Citations |
|---|