EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C23H25N5O5.CH3O3S |
| Net Charge | 0 |
| Average Mass | 547.590 |
| Monoisotopic Mass | 547.17368 |
| SMILES | COc1cc2nc(N3CCN(C(=O)C4COc5ccccc5O4)CC3)nc(N)c2cc1OC.CS(=O)(=O)[O-].[H+] |
| InChI | InChI=1S/C23H25N5O5.CH4O3S/c1-30-18-11-14-15(12-19(18)31-2)25-23(26-21(14)24)28-9-7-27(8-10-28)22(29)20-13-32-16-5-3-4-6-17(16)33-20;1-5(2,3)4/h3-6,11-12,20H,7-10,13H2,1-2H3,(H2,24,25,26);1H3,(H,2,3,4) |
| InChIKey | VJECBOKJABCYMF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| doxazosin mesylate (CHEBI:4709) has part doxazosin (CHEBI:4708) |
| doxazosin mesylate (CHEBI:4709) has role antihypertensive agent (CHEBI:35674) |
| doxazosin mesylate (CHEBI:4709) has role cardiovascular drug (CHEBI:35554) |
| doxazosin mesylate (CHEBI:4709) has role geroprotector (CHEBI:176497) |
| doxazosin mesylate (CHEBI:4709) is a methanesulfonate salt (CHEBI:38037) |
| IUPAC Name |
|---|
| 2-[4-(2,3-dihydro-1,4-benzodioxin-2-ylcarbonyl)piperazin-1-yl]-6,7-dimethoxyquinazolin-4-amine methanesulfonate |
| Synonyms | Source |
|---|---|
| 1-(4-Amino-6,7-dimethoxy-2-quinazolinyl)-4-(1,4-benzodioxan-2-ylcarbonyl)piperazine monomethanesulfonate | ChemIDplus |
| Alfadil | ChEMBL |
| Doxazosin (as mesilate) | ChEMBL |
| Doxazosin methanesulfonate | ChEMBL |
| NSC-759284 | ChEMBL |
| UK-33,274-27 | ChEMBL |
| Brand Names | Source |
|---|---|
| Cardozin xl | ChEMBL |
| Cardura | ChEMBL |
| Cardura xl | ChEMBL |
| Cascor | ChEMBL |
| Colixil xl | ChEMBL |
| Doxadura | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 56686 | ChemSpider |
| D00608 | KEGG DRUG |
| DBSALT001948 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:77883-43-3 | ChemIDplus |
| Citations |
|---|