EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H23N3O15P2 |
| Net Charge | 0 |
| Average Mass | 535.292 |
| Monoisotopic Mass | 535.06044 |
| SMILES | N[C@H]1CO[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3ccc(=O)nc3=O)[C@H](O)[C@@H]2O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H23N3O15P2/c15-5-3-28-13(11(22)8(5)19)31-34(26,27)32-33(24,25)29-4-6-9(20)10(21)12(30-6)17-2-1-7(18)16-14(17)23/h1-2,5-6,8-13,19-22H,3-4,15H2,(H,24,25)(H,26,27)(H,16,18,23)/t5-,6+,8-,9+,10+,11+,12+,13+/m0/s1 |
| InChIKey | GWBAKYBSWHQNMQ-IAZOVDBXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UDP-4-amino-4-deoxy-β-L-arabinopyranose (CHEBI:47025) has functional parent 4-amino-4-deoxy-β-L-arabinopyranose (CHEBI:46993) |
| UDP-4-amino-4-deoxy-β-L-arabinopyranose (CHEBI:47025) has role Escherichia coli metabolite (CHEBI:76971) |
| UDP-4-amino-4-deoxy-β-L-arabinopyranose (CHEBI:47025) is a UDP-amino sugar (CHEBI:35262) |
| UDP-4-amino-4-deoxy-β-L-arabinopyranose (CHEBI:47025) is conjugate acid of UDP-4-amino-4-deoxy-β-L-arabinopyranose(1−) (CHEBI:58708) |
| Incoming Relation(s) |
| UDP-4-deoxy-4-formamido-β-L-arabinopyranose (CHEBI:47027) has functional parent UDP-4-amino-4-deoxy-β-L-arabinopyranose (CHEBI:47025) |
| UDP-4-amino-4-deoxy-β-L-arabinopyranose(1−) (CHEBI:58708) is conjugate base of UDP-4-amino-4-deoxy-β-L-arabinopyranose (CHEBI:47025) |
| IUPAC Name |
|---|
| uridine 5'-[3-(4-amino-4-deoxy-β-L-arabinopyranosyl) dihydrogen diphosphate] |
| Synonyms | Source |
|---|---|
| UDP-4-amino-4-deoxy-beta-L-arabinopyranose | KEGG COMPOUND |
| UDP-4-amino-4-deoxy-L-arabinose | KEGG COMPOUND |
| UDP-L-Ara4N | KEGG COMPOUND |
| UDP-β-L-Ara4N | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C16153 | KEGG COMPOUND |