EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O5 |
| Net Charge | 0 |
| Average Mass | 150.130 |
| Monoisotopic Mass | 150.05282 |
| SMILES | OC[C@@H]1O[C@@H](O)[C@@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a111h-1a_1-4]/1/ |
| InChI | InChI=1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3-,4-,5+/m0/s1 |
| InChIKey | HMFHBZSHGGEWLO-NEEWWZBLSA-N |
| Roles Classification |
|---|
| Biological Role: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-L-ribose (CHEBI:47004) is a L-ribofuranose (CHEBI:47000) |
| α-L-ribose (CHEBI:47004) is enantiomer of α-D-ribose (CHEBI:45506) |
| Incoming Relation(s) |
| α-D-ribose (CHEBI:45506) is enantiomer of α-L-ribose (CHEBI:47004) |
| IUPAC Name |
|---|
| α-L-ribofuranose |
| Synonym | Source |
|---|---|
| α-L-Rib | JCBN |
| Manual Xrefs | Databases |
|---|---|
| G40725TK | GlyTouCan |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8977514 | Beilstein |