EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18N2O8 |
| Net Charge | 0 |
| Average Mass | 390.348 |
| Monoisotopic Mass | 390.10632 |
| SMILES | O=C(O)C1=C/C(=C/C=N\[C@@H](Cc2ccc(O)c(O)c2)C(=O)O)C[C@@H](C(=O)O)N1 |
| InChI | InChI=1S/C18H18N2O8/c21-14-2-1-9(8-15(14)22)5-11(16(23)24)19-4-3-10-6-12(17(25)26)20-13(7-10)18(27)28/h1-4,6,8,11,13,20-22H,5,7H2,(H,23,24)(H,25,26)(H,27,28)/b10-3-,19-4-/t11-,13-/m0/s1 |
| InChIKey | YSNPSKZBOQYUHH-AFUNOPLTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (22624806) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dopaxanthin (CHEBI:4700) is a catecholamine (CHEBI:33567) |
| Synonyms | Source |
|---|---|
| (2S,4E)-4-[(2Z)-2-{[(1S)-1-carboxy-2-(3,4-dihydroxyphenyl)ethyl]imino}ethylidene]-1,2,3,4-tetrahydropyridine-2,6-dicarboxylic acid | HMDB |
| 3-Dihydropyridine-2,6-dicarboxylic acid | HMDB |
| Dopaxanthin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00001587 | KNApSAcK |
| C08543 | KEGG COMPOUND |
| CPD-8672 | MetaCyc |
| HMDB0012221 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:71199-31-0 | KEGG COMPOUND |
| Citations |
|---|