EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16O5 |
| Net Charge | 0 |
| Average Mass | 264.277 |
| Monoisotopic Mass | 264.09977 |
| SMILES | C=C[C@H](OC(C)=O)c1ccc(OC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C14H16O5/c1-5-12(18-9(2)15)11-6-7-13(19-10(3)16)14(8-11)17-4/h5-8,12H,1H2,2-4H3/t12-/m0/s1 |
| InChIKey | NKRBAUXTIWONOV-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1'-acetoxyeugenol acetate (CHEBI:470) has functional parent eugenol (CHEBI:4917) |
| 1'-acetoxyeugenol acetate (CHEBI:470) has role plant metabolite (CHEBI:76924) |
| 1'-acetoxyeugenol acetate (CHEBI:470) is a acetate ester (CHEBI:47622) |
| 1'-acetoxyeugenol acetate (CHEBI:470) is a monomethoxybenzene (CHEBI:25235) |
| 1'-acetoxyeugenol acetate (CHEBI:470) is a phenylpropanoid (CHEBI:26004) |
| IUPAC Name |
|---|
| (1S)-1-[4-(acetyloxy)-3-methoxyphenyl]prop-2-en-1-yl acetate |
| Synonyms | Source |
|---|---|
| 1'-Acetoxyeugenol acetate | KEGG COMPOUND |
| 4-(Acetyloxy)-alpha-ethenyl-3-methoxybenzenemethanol acetate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5752581 | Reaxys |
| CAS:53890-24-7 | KEGG COMPOUND |
| CAS:53890-24-7 | ChemIDplus |
| Citations |
|---|