EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O5 |
| Net Charge | 0 |
| Average Mass | 150.130 |
| Monoisotopic Mass | 150.05282 |
| SMILES | O[C@H]1[C@H](O)[C@H](O)OC[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a122h-1b_1-5]/1/ |
| InChI | InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4+,5-/m1/s1 |
| InChIKey | SRBFZHDQGSBBOR-SQOUGZDYSA-N |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). fundamental metabolite Any metabolite produced by all living cells. fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-D-arabinopyranose (CHEBI:46996) is a D-arabinopyranose (CHEBI:46994) |
| β-D-arabinopyranose (CHEBI:46996) is enantiomer of β-L-arabinopyranose (CHEBI:40886) |
| Incoming Relation(s) |
| (+)-taxifolin 3-O-β-D-arabinopyranoside (CHEBI:75743) has functional parent β-D-arabinopyranose (CHEBI:46996) |
| β-D-Arap-(1→2)-D-Manp (CHEBI:153582) has functional parent β-D-arabinopyranose (CHEBI:46996) |
| β-D-arabinopyranoside (CHEBI:75742) has functional parent β-D-arabinopyranose (CHEBI:46996) |
| β-D-Glcp-(1→3)-β-D-Arap (CHEBI:148939) has functional parent β-D-arabinopyranose (CHEBI:46996) |
| β-L-arabinopyranose (CHEBI:40886) is enantiomer of β-D-arabinopyranose (CHEBI:46996) |
| IUPAC Name |
|---|
| β-D-arabinopyranose |
| Manual Xrefs | Databases |
|---|---|
| G76849VA | GlyTouCan |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1043744 | Gmelin |
| Reaxys:1722182 | Reaxys |