EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | C=C(C)[C@@H]1CC[C@@]2(C1)C(C)=CCC[C@H]2C |
| InChI | InChI=1S/C15H24/c1-11(2)14-8-9-15(10-14)12(3)6-5-7-13(15)4/h6,13-14H,1,5,7-10H2,2-4H3/t13-,14-,15-/m1/s1 |
| InChIKey | WEZDOYDDKIHCLM-RBSFLKMASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hyoscyamus muticus (ncbitaxon:35626) | - | PubMed (7706281) | |
| Vernonia cinerea (IPNI:1164899-2) | - | Article (South African Journal of Botany. 2014, 95, 129-130) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| premnaspirodiene (CHEBI:46971) has parent hydride vetispirane (CHEBI:36754) |
| premnaspirodiene (CHEBI:46971) has role plant metabolite (CHEBI:76924) |
| premnaspirodiene (CHEBI:46971) is a sesquiterpene (CHEBI:35189) |
| premnaspirodiene (CHEBI:46971) is a spiro compound (CHEBI:33599) |
| IUPAC Name |
|---|
| (2R,5S,10R)-6,10-dimethyl-2-(prop-1-en-2-yl)spiro[4.5]dec-6-ene |
| Synonyms | Source |
|---|---|
| (−)-premnaspirodiene | ChEBI |
| (−)-vetispiradiene | ChEBI |
| UniProt Name | Source |
|---|---|
| (−)-vetispiradiene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 6BW | PDBeChem |
| C00007637 | KNApSAcK |
| C12142 | KEGG COMPOUND |
| CPD-4703 | MetaCyc |
| LMPR0103650003 | LIPID MAPS |
| Citations |
|---|