EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H37NO2 |
| Net Charge | 0 |
| Average Mass | 299.499 |
| Monoisotopic Mass | 299.28243 |
| SMILES | CCCCCCCCCCCCC/C=C/[C@H](O)[C@H](N)CO |
| InChI | InChI=1S/C18H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20/h14-15,17-18,20-21H,2-13,16,19H2,1H3/b15-14+/t17-,18+/m1/s1 |
| InChIKey | WWUZIQQURGPMPG-MCXRAWCPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-erythro-sphingosine (CHEBI:46967) is a (2R,3S)-2-aminooctadec-4-ene-1,3-diol (CHEBI:46965) |
| L-erythro-sphingosine (CHEBI:46967) is conjugate base of L-erythro-sphingosine(1+) (CHEBI:77956) |
| L-erythro-sphingosine (CHEBI:46967) is enantiomer of sphingosine (CHEBI:16393) |
| Incoming Relation(s) |
| L-erythro-N-acylsphingosine (CHEBI:83223) has functional parent L-erythro-sphingosine (CHEBI:46967) |
| L-erythro-N-dodecanoylsphingosine (CHEBI:77955) has functional parent L-erythro-sphingosine (CHEBI:46967) |
| L-erythro-sphingosine(1+) (CHEBI:77956) is conjugate acid of L-erythro-sphingosine (CHEBI:46967) |
| sphingosine (CHEBI:16393) is enantiomer of L-erythro-sphingosine (CHEBI:46967) |
| IUPAC Name |
|---|
| (2R,3S,4E)-2-aminooctadec-4-ene-1,3-diol |
| Synonyms | Source |
|---|---|
| L-Erythro-c18-sphingosine | ChemIDplus |
| L-erythro-sphing-4-enine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10777443 | Reaxys |
| Beilstein:4352185 | Beilstein |
| CAS:6036-75-5 | ChemIDplus |