EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H39NO3 |
| Net Charge | 0 |
| Average Mass | 317.514 |
| Monoisotopic Mass | 317.29299 |
| SMILES | CCCCCCCCCCCCCC[C@@H](O)[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C18H39NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(21)18(22)16(19)15-20/h16-18,20-22H,2-15,19H2,1H3/t16-,17+,18-/m0/s1 |
| InChIKey | AERBNCYCJBRYDG-KSZLIROESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phytosphingosine (CHEBI:46961) has functional parent N-acyl-β-D-galactosylphytosphingosine (CHEBI:157775) |
| phytosphingosine (CHEBI:46961) has functional parent sphinganine (CHEBI:16566) |
| phytosphingosine (CHEBI:46961) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| phytosphingosine (CHEBI:46961) has role mouse metabolite (CHEBI:75771) |
| phytosphingosine (CHEBI:46961) is a amino alcohol (CHEBI:22478) |
| phytosphingosine (CHEBI:46961) is a sphingoid (CHEBI:35785) |
| phytosphingosine (CHEBI:46961) is a triol (CHEBI:27136) |
| phytosphingosine (CHEBI:46961) is conjugate base of phytosphingosine(1+) (CHEBI:64124) |
| Incoming Relation(s) |
| C-glycosylphytoceramide (CHEBI:60910) has functional parent phytosphingosine (CHEBI:46961) |
| N-(2-hydroxyhexacosanoyl)phytosphingosine-1-phospho-(1D-myo-inositol) (CHEBI:139522) has functional parent phytosphingosine (CHEBI:46961) |
| N-acylphytosphingosine (CHEBI:31998) has functional parent phytosphingosine (CHEBI:46961) |
| N-acylphytosphingosine 1-phosphate (CHEBI:134540) has functional parent phytosphingosine (CHEBI:46961) |
| N-acylphytosphingosine-1-phosphocholine (CHEBI:78651) has functional parent phytosphingosine (CHEBI:46961) |
| N-hexadecanoylphytosphingosine-1-phosphocholine (CHEBI:78650) has functional parent phytosphingosine (CHEBI:46961) |
| N-hexadecanoylphytosphingosine-1-phosphoethanolamine (CHEBI:82737) has functional parent phytosphingosine (CHEBI:46961) |
| 1-O-(6-deoxy-6-benzamido-α-D-galactopyranosyl)-N-hexacosanoylphytosphingosine (CHEBI:73560) has functional parent phytosphingosine (CHEBI:46961) |
| 1-O-{6-deoxy-6-[N'-(1-naphthyl)ureido]-α-D-galactopyranosyl}-N-hexacosanoylphytosphingosine (CHEBI:73554) has functional parent phytosphingosine (CHEBI:46961) |
| inositol phosphomannosylinositol-1-phospho-N-acylphytosphingosine (CHEBI:139529) has functional parent phytosphingosine (CHEBI:46961) |
| Ins-1-P-Cer(t18:0/2-OH-26:0) (CHEBI:53004) has functional parent phytosphingosine (CHEBI:46961) |
| phytosphingosine 1-phosphate (CHEBI:46970) has functional parent phytosphingosine (CHEBI:46961) |
| β-D-glucosyl-(1↔1')-N-acylphytosphingosine (CHEBI:82923) has functional parent phytosphingosine (CHEBI:46961) |
| phytosphingosine(1+) (CHEBI:64124) is conjugate acid of phytosphingosine (CHEBI:46961) |
| IUPAC Name |
|---|
| (2S,3S,4R)-2-aminooctadecane-1,3,4-triol |
| Synonyms | Source |
|---|---|
| 4-D-Hydroxysphinganine | KEGG COMPOUND |
| Phytosphingosine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C12144 | KEGG COMPOUND |
| LMSP01030001 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1725301 | Beilstein |
| CAS:554-62-1 | ChemIDplus |
| CAS:554-62-1 | KEGG COMPOUND |