EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H27N2O |
| Net Charge | +1 |
| Average Mass | 263.405 |
| Monoisotopic Mass | 263.21179 |
| SMILES | CC[N+](CC)(CC)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C16H26N2O/c1-6-18(7-2,8-3)12-15(19)17-16-13(4)10-9-11-14(16)5/h9-11H,6-8,12H2,1-5H3/p+1 |
| InChIKey | PYEBKOFMWAMBFV-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Application: | local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| QX-314 (CHEBI:46937) has role local anaesthetic (CHEBI:36333) |
| QX-314 (CHEBI:46937) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| 2-[(2,6-dimethylphenyl)amino]-N,N,N-triethyl-2-oxoethanaminium |
| Manual Xrefs | Databases |
|---|---|
| LSM-3262 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3909550 | Beilstein |
| CAS:21306-56-9 | ChemIDplus |