EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H27NO3 |
| Net Charge | 0 |
| Average Mass | 293.407 |
| Monoisotopic Mass | 293.19909 |
| SMILES | CCCCCCCCC(=O)NCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C17H27NO3/c1-3-4-5-6-7-8-9-17(20)18-13-14-10-11-15(19)16(12-14)21-2/h10-12,19H,3-9,13H2,1-2H3,(H,18,20) |
| InChIKey | RGOVYLWUIBMPGK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. lachrymator Any substance that stimulates the corneal nerves in the eves to cause tears. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nonivamide (CHEBI:46936) has role analgesic (CHEBI:35480) |
| nonivamide (CHEBI:46936) has role lachrymator (CHEBI:74136) |
| nonivamide (CHEBI:46936) is a capsaicinoid (CHEBI:46931) |
| nonivamide (CHEBI:46936) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| N-(4-hydroxy-3-methoxybenzyl)nonanamide |
| INNs | Source |
|---|---|
| nonivamida | WHO MedNet |
| nonivamide | WHO MedNet |
| Synonyms | Source |
|---|---|
| AH-23491X | ChEMBL |
| FEMA NO. 2787 | ChEMBL |
| Hansaplast | ChEMBL |
| Hydroxymethoxybenzyl pelargonamide | ChemIDplus |
| N-Nonanoyl vanillylamide | ChemIDplus |
| Nonylic acid vanillyamide | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| Nonivamide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2144300 | Reaxys |
| CAS:2444-46-4 | ChemIDplus |
| Citations |
|---|