EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O2 |
| Net Charge | 0 |
| Average Mass | 86.090 |
| Monoisotopic Mass | 86.03678 |
| SMILES | C=COC(C)=O |
| InChI | InChI=1S/C4H6O2/c1-3-6-4(2)5/h3H,1H2,2H3 |
| InChIKey | XTXRWKRVRITETP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | impact modifier an additive to plastics that enhance toughness and flexibility |
| Application: | impact modifier an additive to plastics that enhance toughness and flexibility |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vinyl acetate (CHEBI:46916) has role impact modifier (CHEBI:747341) |
| vinyl acetate (CHEBI:46916) is a acetate ester (CHEBI:47622) |
| Incoming Relation(s) |
| poly(ethylene-co-vinyl acetate) (CHEBI:166881) has part vinyl acetate (CHEBI:46916) |
| IUPAC Name |
|---|
| ethenyl acetate |
| Synonyms | Source |
|---|---|
| 1-acetoxyethylene | ChemIDplus |
| acetic acid ethenyl ester | NIST Chemistry WebBook |
| acetic acid vinyl ester | NIST Chemistry WebBook |
| acetoxyethene | ChemIDplus |
| Essigsäurevinylester | ChEBI |
| ethenyl ethanoate | NIST Chemistry WebBook |