EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7N5O |
| Net Charge | 0 |
| Average Mass | 165.156 |
| Monoisotopic Mass | 165.06506 |
| SMILES | Cn1c(N)nc(=O)c2ncnc21 |
| InChI | InChI=1S/C6H7N5O/c1-11-4-3(8-2-9-4)5(12)10-6(11)7/h2H,1H3,(H,8,9)(H2,7,10,12) |
| InChIKey | XHBSBNYEHDQRCP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-3-methyl-3,9-dihydro-6H-purin-6-one (CHEBI:46892) is a 3-methylguanine (CHEBI:1604) |
| 2-amino-3-methyl-3,9-dihydro-6H-purin-6-one (CHEBI:46892) is tautomer of 2-amino-3-methyl-3,7-dihydro-6H-purin-6-one (CHEBI:27564) |
| 2-amino-3-methyl-3,9-dihydro-6H-purin-6-one (CHEBI:46892) is tautomer of 2-imino-3-methyl-1,2,3,9-tetrahydro-6H-purin-6-one (CHEBI:46893) |
| Incoming Relation(s) |
| 2-amino-3-methyl-3,7-dihydro-6H-purin-6-one (CHEBI:27564) is tautomer of 2-amino-3-methyl-3,9-dihydro-6H-purin-6-one (CHEBI:46892) |
| 2-imino-3-methyl-1,2,3,9-tetrahydro-6H-purin-6-one (CHEBI:46893) is tautomer of 2-amino-3-methyl-3,9-dihydro-6H-purin-6-one (CHEBI:46892) |
| IUPAC Name |
|---|
| 2-amino-3-methyl-3,9-dihydro-6H-purin-6-one |
| Synonym | Source |
|---|---|
| 2-Amino-3,7-dihydro-3-methyl-6H-purin-6-one | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 3-methylguanine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C02230 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:979248 | Reaxys |
| CAS:2958-98-7 | KEGG COMPOUND |