EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H4NO4 |
| Net Charge | -1 |
| Average Mass | 166.112 |
| Monoisotopic Mass | 166.01458 |
| SMILES | O=C(O)c1ccc(C(=O)[O-])nc1 |
| InChI | InChI=1S/C7H5NO4/c9-6(10)4-1-2-5(7(11)12)8-3-4/h1-3H,(H,9,10)(H,11,12)/p-1 |
| InChIKey | LVPMIMZXDYBCDF-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-carboxypyridine-2-carboxylate (CHEBI:46872) is a isocinchomeronate(1−) (CHEBI:46870) |
| 5-carboxypyridine-2-carboxylate (CHEBI:46872) is tautomer of 6-carboxypyridine-3-carboxylate (CHEBI:46873) |
| Incoming Relation(s) |
| 6-carboxypyridine-3-carboxylate (CHEBI:46873) is tautomer of 5-carboxypyridine-2-carboxylate (CHEBI:46872) |
| IUPAC Name |
|---|
| 5-carboxypyridine-2-carboxylate |
| Registry Numbers | Sources |
|---|---|
| Gmelin:847789 | Gmelin |