EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:46860 - cinchomeronic acid
| Formula | C7H5NO4 |
| Net Charge | 0 |
| Average Mass | 167.120 |
| Monoisotopic Mass | 167.02186 |
| SMILES | O=C(O)c1ccncc1C(=O)O |
| InChI | InChI=1S/C7H5NO4/c9-6(10)4-1-2-8-3-5(4)7(11)12/h1-3H,(H,9,10)(H,11,12) |
| InChIKey | MUYSADWCWFFZKR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cinchomeronic acid (CHEBI:46860) is a pyridinedicarboxylic acid (CHEBI:36112) |
| cinchomeronic acid (CHEBI:46860) is conjugate acid of cinchomeronate(1−) (CHEBI:46862) |
| Incoming Relation(s) |
| 5-hydroxy-6-methylpyridine-3,4-dicarboxylic acid (CHEBI:17978) has functional parent cinchomeronic acid (CHEBI:46860) |
| cinchomeronate(1−) (CHEBI:46862) is conjugate base of cinchomeronic acid (CHEBI:46860) |
| IUPAC Name |
|---|
| pyridine-3,4-dicarboxylic acid |
| Synonyms | Source |
|---|---|
| 3,4-pyridinedicarboxylic acid | NIST Chemistry WebBook |
| Cinchomeronic acid | ChemIDplus |
| Citations |
|---|