EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O2 |
| Net Charge | 0 |
| Average Mass | 166.220 |
| Monoisotopic Mass | 166.09938 |
| SMILES | [H][C@]1(C(=C)C=O)CC[C@H](C)[C@@]1([H])C=O |
| InChI | InChI=1S/C10H14O2/c1-7-3-4-9(8(2)5-11)10(7)6-12/h5-7,9-10H,2-4H2,1H3/t7-,9+,10+/m0/s1 |
| InChIKey | BORBLDJNKYHVJP-FXBDTBDDSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dysaphis plantaginea (ncbitaxon:214836) | - | PubMed (19023626) | |
| Teucrium marum (ncbitaxon:711380) | - | PubMed (15763383) |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dolichodial (CHEBI:4685) has role animal metabolite (CHEBI:75767) |
| dolichodial (CHEBI:4685) has role plant metabolite (CHEBI:76924) |
| dolichodial (CHEBI:4685) has role volatile oil component (CHEBI:27311) |
| dolichodial (CHEBI:4685) is a dialdehyde (CHEBI:38124) |
| dolichodial (CHEBI:4685) is a iridoid monoterpenoid (CHEBI:50563) |
| dolichodial (CHEBI:4685) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| (1R,2S,5S)-2-methyl-5-(3-oxoprop-1-en-2-yl)cyclopentanecarbaldehyde |
| Synonyms | Source |
|---|---|
| (1R,2S,5S)-2-(1-formylvinyl)-5-methylcyclopentanecarbaldehyde | IUPAC |
| Dolichodial | KEGG COMPOUND |
| Iridial | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00003079 | KNApSAcK |
| C09777 | KEGG COMPOUND |
| Dolichodial | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2207598 | Reaxys |
| CAS:5951-57-5 | KEGG COMPOUND |
| Citations |
|---|