EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H4NO4 |
| Net Charge | -1 |
| Average Mass | 166.112 |
| Monoisotopic Mass | 166.01458 |
| SMILES | O=C(O)c1cccnc1C(=O)[O-] |
| InChI | InChI=1S/C7H5NO4/c9-6(10)4-2-1-3-8-5(4)7(11)12/h1-3H,(H,9,10)(H,11,12)/p-1 |
| InChIKey | GJAWHXHKYYXBSV-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-carboxypyridine-2-carboxylate (CHEBI:46832) is a quinolinate(1−) (CHEBI:46828) |
| 3-carboxypyridine-2-carboxylate (CHEBI:46832) is tautomer of 2-carboxypyridine-3-carboxylate (CHEBI:46833) |
| Incoming Relation(s) |
| 2-carboxypyridine-3-carboxylate (CHEBI:46833) is tautomer of 3-carboxypyridine-2-carboxylate (CHEBI:46832) |
| IUPAC Name |
|---|
| 3-carboxypyridine-2-carboxylate |
| Registry Numbers | Sources |
|---|---|
| Gmelin:329234 | Gmelin |