EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H2N4O3 |
| Net Charge | -2 |
| Average Mass | 166.096 |
| Monoisotopic Mass | 166.01379 |
| SMILES | O=c1nc([O-])nc2nc([O-])nc12 |
| InChI | InChI=1S/C5H4N4O3/c10-3-1-2(7-4(11)6-1)8-5(12)9-3/h(H4,6,7,8,9,10,11,12)/p-2 |
| InChIKey | LEHOTFFKMJEONL-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-oxo-6,7-dihydro-1H-purine-2,8-diolate (CHEBI:46825) is a urate(2−) (CHEBI:27216) |
| 6-oxo-6,7-dihydro-1H-purine-2,8-diolate (CHEBI:46825) is tautomer of 2,6,8-trioxo-3,6,8,9-tetrahydro-2H-purine-1,7-diide (CHEBI:46826) |
| Incoming Relation(s) |
| 2,6,8-trioxo-3,6,8,9-tetrahydro-2H-purine-1,7-diide (CHEBI:46826) is tautomer of 6-oxo-6,7-dihydro-1H-purine-2,8-diolate (CHEBI:46825) |
| IUPAC Name |
|---|
| 6-oxo-6,7-dihydro-1H-purine-2,8-diolate |