EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27N3O5S2 |
| Net Charge | 0 |
| Average Mass | 441.575 |
| Monoisotopic Mass | 441.13921 |
| SMILES | CN(CCOc1ccc(NS(C)(=O)=O)cc1)CCc1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H27N3O5S2/c1-22(13-12-16-4-6-17(7-5-16)20-28(2,23)24)14-15-27-19-10-8-18(9-11-19)21-29(3,25)26/h4-11,20-21H,12-15H2,1-3H3 |
| InChIKey | IXTMWRCNAAVVAI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | potassium channel blocker An agent that inhibits cell membrane glycoproteins that are selectively permeable to potassium ions. |
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dofetilide (CHEBI:4681) has role anti-arrhythmia drug (CHEBI:38070) |
| dofetilide (CHEBI:4681) has role potassium channel blocker (CHEBI:50509) |
| dofetilide (CHEBI:4681) is a aromatic ether (CHEBI:35618) |
| dofetilide (CHEBI:4681) is a sulfonamide (CHEBI:35358) |
| dofetilide (CHEBI:4681) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-(4-{2-[methyl(2-{4-[(methylsulfonyl)amino]phenoxy}ethyl)amino]ethyl}phenyl)methanesulfonamide |
| INNs | Source |
|---|---|
| dofetilida | ChemIDplus |
| dofetilide | ChemIDplus |
| dofetilidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| beta-((p-Methanesulfonamidophenethyl)methylamino)methanesulfono-p-phenetidide | ChemIDplus |
| Dofetilide | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Tikosyn | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3572833 | Reaxys |
| CAS:115256-11-6 | ChemIDplus |
| Citations |
|---|