EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9NO |
| Net Charge | 0 |
| Average Mass | 123.155 |
| Monoisotopic Mass | 123.06841 |
| SMILES | [H][C@@]12CC(=O)N1C=C[C@@H]2C |
| InChI | InChI=1S/C7H9NO/c1-5-2-3-8-6(5)4-7(8)9/h2-3,5-6H,4H2,1H3/t5-,6-/m0/s1 |
| InChIKey | YKMONJZIUAOVEM-WDSKDSINSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1β-methylcarbapenem (CHEBI:46764) has functional parent carbapenem (CHEBI:46765) |
| 1β-methylcarbapenem (CHEBI:46764) is a carbapenems (CHEBI:46633) |
| IUPAC Name |
|---|
| 1β-methyl-2,3-didehydro-1-carbapenam |
| Synonym | Source |
|---|---|
| (4S,5S)-4-methyl-1-azabicyclo[3.2.0]hept-2-en-7-one | IUPAC |