EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H30Cl2N4O4 |
| Net Charge | 0 |
| Average Mass | 581.500 |
| Monoisotopic Mass | 580.16441 |
| SMILES | COc1ccc(C2=N[C@H](c3ccc(Cl)cc3)[C@H](c3ccc(Cl)cc3)N2C(=O)N2CCNC(=O)C2)c(OC(C)C)c1 |
| InChI | InChI=1S/C30H30Cl2N4O4/c1-18(2)40-25-16-23(39-3)12-13-24(25)29-34-27(19-4-8-21(31)9-5-19)28(20-6-10-22(32)11-7-20)36(29)30(38)35-15-14-33-26(37)17-35/h4-13,16,18,27-28H,14-15,17H2,1-3H3,(H,33,37)/t27-,28+/m1/s1 |
| InChIKey | BDUHCSBCVGXTJM-IZLXSDGUSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nutlin-3 (CHEBI:46742) has role anticoronaviral agent (CHEBI:149553) |
| Nutlin-3 (CHEBI:46742) is a Nutlin (CHEBI:46741) |
| Nutlin-3 (CHEBI:46742) is a piperazinone (CHEBI:46846) |
| IUPAC Name |
|---|
| rel-4-{[(4R,5S)-4,5-bis(4-chlorophenyl)-2-{2-[(propan-2-yl)oxy]-4-methoxyphenyl}-4,5-dihydro-1H-imidazol-1-yl]carbonyl}piperazin-2-one |
| Synonyms | Source |
|---|---|
| cis-4-{[4,5-bis(4-chlorophenyl)-2-(2-isopropoxy-4-methoxyphenyl)-4,5-dihydroimidazol-1-yl]carbonyl}piperazin-2-one | ChEBI |
| nutlin 3 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:10243211 | Beilstein |
| CAS:548472-68-0 | ChemIDplus |