EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24NO3.Cl |
| Net Charge | 0 |
| Average Mass | 337.847 |
| Monoisotopic Mass | 337.14447 |
| SMILES | CC(CCc1ccc(O)cc1)[NH2+]CCc1ccc(O)c(O)c1.[Cl-] |
| InChI | InChI=1S/C18H23NO3.ClH/c1-13(2-3-14-4-7-16(20)8-5-14)19-11-10-15-6-9-17(21)18(22)12-15;/h4-9,12-13,19-22H,2-3,10-11H2,1H3;1H |
| InChIKey | BQKADKWNRWCIJL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| Applications: | sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dobutamine hydrochloride (CHEBI:4671) has part dobutamine (CHEBI:4670) |
| dobutamine hydrochloride (CHEBI:4671) has role cardiotonic drug (CHEBI:38147) |
| dobutamine hydrochloride (CHEBI:4671) has role cardiovascular drug (CHEBI:35554) |
| dobutamine hydrochloride (CHEBI:4671) has role sympathomimetic agent (CHEBI:35524) |
| dobutamine hydrochloride (CHEBI:4671) has role β-adrenergic agonist (CHEBI:35522) |
| dobutamine hydrochloride (CHEBI:4671) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N-[2-(3,4-dihydroxyphenyl)ethyl]-4-(4-hydroxyphenyl)butan-2-aminium chloride |
| Synonyms | Source |
|---|---|
| (±)-4-(2-((3-(p-hydroxyphenyl)-1-methylpropyl)amino)ethyl)pyrocatechol hydrochloride | ChemIDplus |
| 4-(2-{[4-(4-hydroxyphenyl)butan-2-yl]amino}ethyl)benzene-1,2-diol hydrochloride | IUPAC |
| 46236 | ChEMBL |
| dobutamine HCl | ChemIDplus |
| NSC-299583 | ChEMBL |
| DL-dobutamine hydrochloride | ChemIDplus |
| Brand Names | Source |
|---|---|
| Dobutrex | ChEMBL |
| Inotrex | ChEMBL |
| Posiject | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6023420 | Beilstein |
| CAS:49745-95-1 | ChemIDplus |
| CAS:49745-95-1 | KEGG DRUG |
| Citations |
|---|