EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24NO3.Cl |
| Net Charge | 0 |
| Average Mass | 337.847 |
| Monoisotopic Mass | 337.14447 |
| SMILES | CC(CCc1ccc(O)cc1)[NH2+]CCc1ccc(O)c(O)c1.[Cl-] |
| InChI | InChI=1S/C18H23NO3.ClH/c1-13(2-3-14-4-7-16(20)8-5-14)19-11-10-15-6-9-17(21)18(22)12-15;/h4-9,12-13,19-22H,2-3,10-11H2,1H3;1H |
| InChIKey | BQKADKWNRWCIJL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| Applications: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dobutamine hydrochloride (CHEBI:4671) has part dobutamine (CHEBI:4670) |
| dobutamine hydrochloride (CHEBI:4671) has role cardiotonic drug (CHEBI:38147) |
| dobutamine hydrochloride (CHEBI:4671) has role sympathomimetic agent (CHEBI:35524) |
| dobutamine hydrochloride (CHEBI:4671) has role β-adrenergic agonist (CHEBI:35522) |
| dobutamine hydrochloride (CHEBI:4671) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N-[2-(3,4-dihydroxyphenyl)ethyl]-4-(4-hydroxyphenyl)butan-2-aminium chloride |
| Synonyms | Source |
|---|---|
| dobutamine HCl | ChemIDplus |
| DL-dobutamine hydrochloride | ChemIDplus |
| (±)-4-(2-((3-(p-hydroxyphenyl)-1-methylpropyl)amino)ethyl)pyrocatechol hydrochloride | ChemIDplus |
| 4-(2-{[4-(4-hydroxyphenyl)butan-2-yl]amino}ethyl)benzene-1,2-diol hydrochloride | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6023420 | Beilstein |
| CAS:49745-95-1 | KEGG DRUG |
| CAS:49745-95-1 | ChemIDplus |