EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O |
| Net Charge | 0 |
| Average Mass | 182.307 |
| Monoisotopic Mass | 182.16707 |
| SMILES | C[C@H]1CCC[C@@]2(C)CCCC[C@]12O |
| InChI | InChI=1S/C12H22O/c1-10-6-5-8-11(2)7-3-4-9-12(10,11)13/h10,13H,3-9H2,1-2H3/t10-,11+,12-/m0/s1 |
| InChIKey | JLPUXFOGCDVKGO-TUAOUCFPSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-geosmin (CHEBI:46702) is a geosmin (CHEBI:46703) |
| (−)-geosmin (CHEBI:46702) is enantiomer of (+)-geosmin (CHEBI:46705) |
| Incoming Relation(s) |
| (+)-geosmin (CHEBI:46705) is enantiomer of (−)-geosmin (CHEBI:46702) |
| IUPAC Name |
|---|
| (4S,4aS,8aR)-4,8a-dimethyloctahydronaphthalen-4a(2H)-ol |
| Synonyms | Source |
|---|---|
| (4S-(4α,4aα,8aβ))-octahydro-4,8a-dimethyl-4a(2H)-naphthol | ChemIDplus |
| (-)-Geosmin | KEGG COMPOUND |
| Geosmin | ChemIDplus |
| trans-1,10-dimethyl-trans-decalol | ChEBI |
| octahydro-4α,8aβ-dimethyl-4aα(2H)-naphthol | ChemIDplus |
| trans-1,10-Dimethyl-trans-9-decalol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (−)-geosmin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2410491 | Beilstein |
| Beilstein:4656415 | Beilstein |
| CAS:19700-21-1 | ChemIDplus |
| CAS:19700-21-1 | KEGG COMPOUND |
| Citations |
|---|