EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4669 - Divostroside
| Formula | C30H46O8 |
| Net Charge | 0 |
| Average Mass | 534.690 |
| Monoisotopic Mass | 534.31927 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@]4(O)CC[C@]([H])(C5=CC(=O)OC5)[C@@]4(C)C[C@@H](O)[C@]3([H])[C@@]1(C)CC[C@H](O[C@H]1C[C@H](OC)[C@H](O)[C@H](C)O1)C2 |
| InChI | InChI=1S/C30H46O8/c1-16-27(33)23(35-4)13-25(37-16)38-19-7-9-28(2)18(12-19)5-6-21-26(28)22(31)14-29(3)20(8-10-30(21,29)34)17-11-24(32)36-15-17/h11,16,18-23,25-27,31,33-34H,5-10,12-15H2,1-4H3/t16-,18+,19-,20+,21+,22+,23-,25-,26+,27+,28-,29+,30-/m0/s1 |
| InChIKey | LEORFFVSVUWAEY-KKFKOBSISA-N |
| Roles Classification |
|---|
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Divostroside (CHEBI:4669) is a cardenolide glycoside (CHEBI:38092) |
| Synonyms | Source |
|---|---|
| Divostroside | KEGG COMPOUND |
| Sarmentogenin 3-O-alpha-L-diginoside | KEGG COMPOUND |