EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O7 |
| Net Charge | 0 |
| Average Mass | 196.155 |
| Monoisotopic Mass | 196.05830 |
| SMILES | O=C(O)[C@@H](O)[C@H](O)[C@H](O)[C@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[A1222h]/1/ |
| InChI | InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3-,4-,5+/m1/s1 |
| InChIKey | RGHNJXZEOKUKBD-AIHAYLRMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (13831814) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-altronic acid (CHEBI:46644) has role Escherichia coli metabolite (CHEBI:76971) |
| D-altronic acid (CHEBI:46644) is a altronic acid (CHEBI:33532) |
| D-altronic acid (CHEBI:46644) is conjugate acid of D-altronate (CHEBI:17360) |
| Incoming Relation(s) |
| D-altronate (CHEBI:17360) is conjugate base of D-altronic acid (CHEBI:46644) |
| IUPAC Name |
|---|
| D-altronic acid |
| UniProt Name | Source |
|---|---|
| D-altronic acid | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00817 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726061 | Reaxys |
| CAS:24871-35-0 | ChemIDplus |
| Citations |
|---|