EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO6 |
| Net Charge | 0 |
| Average Mass | 195.171 |
| Monoisotopic Mass | 195.07429 |
| SMILES | N[C@@H](C(=O)O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H13NO6/c7-3(6(12)13)5(11)4(10)2(9)1-8/h2-5,8-11H,1,7H2,(H,12,13)/t2-,3-,4+,5-/m1/s1 |
| InChIKey | UFYKDFXCZBTLOO-SQOUGZDYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-galactosaminic acid (CHEBI:46641) is a galactosaminic acid (CHEBI:24157) |
| D-galactosaminic acid (CHEBI:46641) is conjugate acid of D-galactosaminate (CHEBI:46642) |
| Incoming Relation(s) |
| D-galactosaminate (CHEBI:46642) is conjugate base of D-galactosaminic acid (CHEBI:46641) |
| IUPAC Name |
|---|
| 2-amino-2-deoxy-D-galactonic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726035 | Reaxys |
| CAS:3646-68-2 | ChemIDplus |