EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10N2O7P2 |
| Net Charge | 0 |
| Average Mass | 272.090 |
| Monoisotopic Mass | 271.99632 |
| SMILES | O=P(O)(O)C(O)(Cn1ccnc1)P(=O)(O)O |
| InChI | InChI=1S/C5H10N2O7P2/c8-5(15(9,10)11,16(12,13)14)3-7-2-1-6-4-7/h1-2,4,8H,3H2,(H2,9,10,11)(H2,12,13,14) |
| InChIKey | XRASPMIURGNCCH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zoledronic acid (CHEBI:46557) has role analgesic (CHEBI:35480) |
| zoledronic acid (CHEBI:46557) has role antineoplastic agent (CHEBI:35610) |
| zoledronic acid (CHEBI:46557) has role bone density conservation agent (CHEBI:50646) |
| zoledronic acid (CHEBI:46557) is a 1,1-bis(phosphonic acid) (CHEBI:77383) |
| zoledronic acid (CHEBI:46557) is a imidazoles (CHEBI:24780) |
| zoledronic acid (CHEBI:46557) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| [1-hydroxy-2-(1H-imidazol-1-yl)ethane-1,1-diyl]bis(phosphonic acid) |
| INN | Source |
|---|---|
| zoledronic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| (1-hydroxy-2-(1H-imidazol-1-yl)ethylidene)bisphosphonic acid | ChemIDplus |
| (1-hydroxy-2-imidazol-1-ylethylidene)diphosphonic acid | ChemIDplus |
| Anhydrous zoledronic acid | ChEMBL |
| ZOL | DrugBank |
| ZOLEDRONIC ACID | PDBeChem |
| zoledronic acid anhydrous | ChEMBL |
| Brand Name | Source |
|---|---|
| Reclast | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Gmelin:2609374 | Gmelin |
| Beilstein:9205049 | Beilstein |
| CAS:118072-93-8 | KEGG DRUG |
| CAS:118072-93-8 | DrugBank |
| CAS:118072-93-8 | ChemIDplus |
| Citations |
|---|