EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:46548 - zardaverine
| Formula | C12H10F2N2O3 |
| Net Charge | 0 |
| Average Mass | 268.219 |
| Monoisotopic Mass | 268.06595 |
| SMILES | COc1cc(-c2ccc(=O)nn2)ccc1OC(F)F |
| InChI | InChI=1S/C12H10F2N2O3/c1-18-10-6-7(2-4-9(10)19-12(13)14)8-3-5-11(17)16-15-8/h2-6,12H,1H3,(H,16,17) |
| InChIKey | HJMQDJPMQIHLPB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.4.* (phosphoric diester hydrolase) inhibitor An EC 3.1.* (ester hydrolase) inhibitor that interferes with the action of a phosphoric diester hydrolase (EC 3.1.4.*). |
| Applications: | anti-asthmatic drug A drug used to treat asthma. peripheral nervous system drug A drug that acts principally at one or more sites within the peripheral neuroeffector systems, the autonomic system, and motor nerve-skeletal system. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zardaverine (CHEBI:46548) has role anti-asthmatic drug (CHEBI:49167) |
| zardaverine (CHEBI:46548) has role bronchodilator agent (CHEBI:35523) |
| zardaverine (CHEBI:46548) has role EC 3.1.4.* (phosphoric diester hydrolase) inhibitor (CHEBI:50218) |
| zardaverine (CHEBI:46548) has role peripheral nervous system drug (CHEBI:49110) |
| zardaverine (CHEBI:46548) is a organofluorine compound (CHEBI:37143) |
| zardaverine (CHEBI:46548) is a pyridazinone (CHEBI:26414) |
| IUPAC Name |
|---|
| 6-[4-(difluoromethoxy)-3-methoxyphenyl]pyridazin-3(2H)-one |
| INNs | Source |
|---|---|
| zardaverine | ChemIDplus |
| zardaverina | ChemIDplus |
| zardaverinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 6-(4-DIFLUOROMETHOXY-3-METHOXY-PHENYL)-2H-PYRIDAZIN-3-ONE | PDBeChem |
| 6-(4-(Difluoromethoxy)-3-methoxyphenyl)-3(2H)-pyridazinone | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:101975-10-4 | ChemIDplus |
| Citations |
|---|