EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H40N8O4 |
| Net Charge | 0 |
| Average Mass | 504.636 |
| Monoisotopic Mass | 504.31725 |
| SMILES | OCCN(CCO)c1nc(N2CCCCC2)c2nc(N(CCO)CCO)nc(N3CCCCC3)c2n1 |
| InChI | InChI=1S/C24H40N8O4/c33-15-11-31(12-16-34)23-26-20-19(21(27-23)29-7-3-1-4-8-29)25-24(32(13-17-35)14-18-36)28-22(20)30-9-5-2-6-10-30/h33-36H,1-18H2 |
| InChIKey | IZEKFCXSFNUWAM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.5.4.4 (adenosine deaminase) inhibitor An EC 3.5.4.* (non-peptide cyclic amidine C-N hydrolase) inhibitor that interferes with the action of adenosine deaminase (EC 3.5.4.4). |
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dipyridamole (CHEBI:4653) has role adenosine phosphodiesterase inhibitor (CHEBI:50444) |
| dipyridamole (CHEBI:4653) has role EC 3.5.4.4 (adenosine deaminase) inhibitor (CHEBI:50445) |
| dipyridamole (CHEBI:4653) has role platelet aggregation inhibitor (CHEBI:50427) |
| dipyridamole (CHEBI:4653) has role vasodilator agent (CHEBI:35620) |
| dipyridamole (CHEBI:4653) is a piperidines (CHEBI:26151) |
| dipyridamole (CHEBI:4653) is a pyrimidopyrimidine (CHEBI:48514) |
| dipyridamole (CHEBI:4653) is a tertiary amino compound (CHEBI:50996) |
| dipyridamole (CHEBI:4653) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| 2,2',2'',2'''-[(4,8-dipiperidin-1-ylpyrimido[5,4-d]pyrimidine-2,6-diyl)dinitrilo]tetraethanol |
| INNs | Source |
|---|---|
| dipyridamole | ChemIDplus |
| dipyridamolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Dipyridamine | DrugBank |
| Dipyudamine | DrugBank |
| Dypyridamol | DrugBank |
| Brand Names | Source |
|---|---|
| Cardoxin | ChEBI |
| Cleridium 150 | DrugBank |
| Curantyl | DrugBank |
| dipiridamol | ChemIDplus |
| Persantin | DrugBank |
| Citations |
|---|