EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4653 - dipyridamole
| Formula | C24H40N8O4 |
| Net Charge | 0 |
| Average Mass | 504.636 |
| Monoisotopic Mass | 504.31725 |
| SMILES | OCCN(CCO)c1nc(N2CCCCC2)c2nc(N(CCO)CCO)nc(N3CCCCC3)c2n1 |
| InChI | InChI=1S/C24H40N8O4/c33-15-11-31(12-16-34)23-26-20-19(21(27-23)29-7-3-1-4-8-29)25-24(32(13-17-35)14-18-36)28-22(20)30-9-5-2-6-10-30/h33-36H,1-18H2 |
| InChIKey | IZEKFCXSFNUWAM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. EC 3.5.4.4 (adenosine deaminase) inhibitor An EC 3.5.4.* (non-peptide cyclic amidine C-N hydrolase) inhibitor that interferes with the action of adenosine deaminase (EC 3.5.4.4). antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antirheumatic drug A drug used to treat rheumatoid arthritis. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. anticoagulant An agent that prevents blood clotting. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. vasodilator agent A drug used to cause dilation of the blood vessels. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dipyridamole (CHEBI:4653) has role adenosine phosphodiesterase inhibitor (CHEBI:50444) |
| dipyridamole (CHEBI:4653) has role anti-anaemic agent (CHEBI:75835) |
| dipyridamole (CHEBI:4653) has role anti-HIV agent (CHEBI:64946) |
| dipyridamole (CHEBI:4653) has role anticoagulant (CHEBI:50249) |
| dipyridamole (CHEBI:4653) has role antihypertensive agent (CHEBI:35674) |
| dipyridamole (CHEBI:4653) has role antineoplastic agent (CHEBI:35610) |
| dipyridamole (CHEBI:4653) has role antirheumatic drug (CHEBI:35842) |
| dipyridamole (CHEBI:4653) has role antiviral agent (CHEBI:22587) |
| dipyridamole (CHEBI:4653) has role cardiovascular drug (CHEBI:35554) |
| dipyridamole (CHEBI:4653) has role EC 3.5.4.4 (adenosine deaminase) inhibitor (CHEBI:50445) |
| dipyridamole (CHEBI:4653) has role platelet aggregation inhibitor (CHEBI:50427) |
| dipyridamole (CHEBI:4653) has role vasodilator agent (CHEBI:35620) |
| dipyridamole (CHEBI:4653) is a piperidines (CHEBI:26151) |
| dipyridamole (CHEBI:4653) is a pyrimidopyrimidine (CHEBI:48514) |
| dipyridamole (CHEBI:4653) is a tertiary amino compound (CHEBI:50996) |
| dipyridamole (CHEBI:4653) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| 2,2',2'',2'''-[(4,8-dipiperidin-1-ylpyrimido[5,4-d]pyrimidine-2,6-diyl)dinitrilo]tetraethanol |
| INNs | Source |
|---|---|
| dipyridamole | ChemIDplus |
| dipyridamolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| B01AC07 | ChEMBL |
| Dipyridamine | DrugBank |
| Dipyudamine | DrugBank |
| Dypyridamol | DrugBank |
| NSC-515776 | ChEMBL |
| RA-8 | ChEMBL |
| Brand Names | Source |
|---|---|
| Attia | ChEMBL |
| Cardoxin | ChEBI |
| Cerebrovase 100 | ChEMBL |
| Cerebrovase 25 | ChEMBL |
| Cleridium 150 | DrugBank |
| Curantyl | DrugBank |
| Citations |
|---|