EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H35NO4 |
| Net Charge | 0 |
| Average Mass | 425.569 |
| Monoisotopic Mass | 425.25661 |
| SMILES | [H][C@]1(C(C)(C)O)C[C@@]23CC[C@]1(OC)[C@@H]1Oc4c(O)ccc5c4[C@@]12CCN(CC1CC1)[C@@H]3C5 |
| InChI | InChI=1S/C26H35NO4/c1-23(2,29)18-13-24-8-9-26(18,30-3)22-25(24)10-11-27(14-15-4-5-15)19(24)12-16-6-7-17(28)21(31-22)20(16)25/h6-7,15,18-19,22,28-29H,4-5,8-14H2,1-3H3/t18-,19-,22-,24-,25+,26-/m1/s1 |
| InChIKey | OIJXLIIMXHRJJH-KNLIIKEYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Diprenorphine (CHEBI:4650) is a morphinane alkaloid (CHEBI:25418) |
| Synonym | Source |
|---|---|
| Diprenorphine | KEGG COMPOUND |