EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O5 |
| Net Charge | 0 |
| Average Mass | 150.130 |
| Monoisotopic Mass | 150.05282 |
| SMILES | OC[C@H]1O[C@@H](O)[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a212h-1b_1-4]/1/ |
| InChI | InChI=1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3+,4-,5-/m1/s1 |
| InChIKey | HMFHBZSHGGEWLO-KKQCNMDGSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-D-xylofuranose (CHEBI:46432) is a D-xylose (CHEBI:65327) |
| Incoming Relation(s) |
| β-D-Glcp-(1→5)-β-D-Xylf (CHEBI:151762) has functional parent β-D-xylofuranose (CHEBI:46432) |
| β-D-Xylf-(1→6)-β-D-Glcp (CHEBI:151964) has functional parent β-D-xylofuranose (CHEBI:46432) |
| IUPAC Name |
|---|
| β-D-xylofuranose |
| Synonyms | Source |
|---|---|
| (2R,3R,4R,5R)-5-(hydroxymethyl)oxolane-2,3,4-triol | IUPAC |
| b-Xylf | IUPAC |
| Registry Numbers | Sources |
|---|---|
| CAS:37110-85-3 | ChemIDplus |