EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:46345 - 5-fluorouracil
| Formula | C4H3FN2O2 |
| Net Charge | 0 |
| Average Mass | 130.078 |
| Monoisotopic Mass | 130.01786 |
| SMILES | O=c1ncc(F)c(=O)n1 |
| InChI | InChI=1S/C4H3FN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9) |
| InChIKey | GHASVSINZRGABV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-fluorouracil (CHEBI:46345) has functional parent uracil (CHEBI:17568) |
| 5-fluorouracil (CHEBI:46345) has role antimetabolite (CHEBI:35221) |
| 5-fluorouracil (CHEBI:46345) has role antineoplastic agent (CHEBI:35610) |
| 5-fluorouracil (CHEBI:46345) has role environmental contaminant (CHEBI:78298) |
| 5-fluorouracil (CHEBI:46345) has role immunosuppressive agent (CHEBI:35705) |
| 5-fluorouracil (CHEBI:46345) has role radiosensitizing agent (CHEBI:132992) |
| 5-fluorouracil (CHEBI:46345) has role xenobiotic (CHEBI:35703) |
| 5-fluorouracil (CHEBI:46345) is a nucleobase analogue (CHEBI:67142) |
| 5-fluorouracil (CHEBI:46345) is a organofluorine compound (CHEBI:37143) |
| IUPAC Names |
|---|
| 5-fluoropyrimidine-2,4(1H,3H)-dione |
| 5-fluorouracil |
| INNs | Source |
|---|---|
| fluorouracil | WHO MedNet |
| fluorouracil | ChemIDplus |
| fluorouracilo | ChemIDplus |
| fluorouracilum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-Fluoracil | ChemIDplus |
| 5-Fluoropyrimidine-2,4-dione | ChemIDplus |
| 5-Fluorouracil | KEGG COMPOUND |
| 5-FU | KEGG COMPOUND |
| Fluorouracil | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 26 | DrugCentral |
| C07649 | KEGG COMPOUND |
| D00584 | KEGG DRUG |
| DB00544 | DrugBank |
| Fluorouracil | Wikipedia |
| HMDB0014684 | HMDB |
| LSM-4261 | LINCS |
| URF | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:127172 | Reaxys |
| Beilstein:127172 | Beilstein |
| CAS:51-21-8 | ChemIDplus |
| CAS:51-21-8 | KEGG COMPOUND |
| Citations |
|---|