EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H3FN2O2 |
| Net Charge | 0 |
| Average Mass | 130.078 |
| Monoisotopic Mass | 130.01786 |
| SMILES | O=c1ncc(F)c(=O)n1 |
| InChI | InChI=1S/C4H3FN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9) |
| InChIKey | GHASVSINZRGABV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| Applications: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-fluorouracil (CHEBI:46345) has functional parent uracil (CHEBI:17568) |
| 5-fluorouracil (CHEBI:46345) has role antimetabolite (CHEBI:35221) |
| 5-fluorouracil (CHEBI:46345) has role antineoplastic agent (CHEBI:35610) |
| 5-fluorouracil (CHEBI:46345) has role environmental contaminant (CHEBI:78298) |
| 5-fluorouracil (CHEBI:46345) has role immunosuppressive agent (CHEBI:35705) |
| 5-fluorouracil (CHEBI:46345) has role radiosensitizing agent (CHEBI:132992) |
| 5-fluorouracil (CHEBI:46345) has role xenobiotic (CHEBI:35703) |
| 5-fluorouracil (CHEBI:46345) is a nucleobase analogue (CHEBI:67142) |
| 5-fluorouracil (CHEBI:46345) is a organofluorine compound (CHEBI:37143) |
| IUPAC Names |
|---|
| 5-fluoropyrimidine-2,4(1H,3H)-dione |
| 5-fluorouracil |
| INNs | Source |
|---|---|
| fluorouracil | WHO MedNet |
| fluorouracil | ChemIDplus |
| fluorouracilo | ChemIDplus |
| fluorouracilum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-Fluoracil | ChemIDplus |
| 5-Fluoropyrimidine-2,4-dione | ChemIDplus |
| 5-Fluorouracil | KEGG COMPOUND |
| 5-FU | KEGG COMPOUND |
| Fluorouracil | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 26 | DrugCentral |
| C07649 | KEGG COMPOUND |
| D00584 | KEGG DRUG |
| DB00544 | DrugBank |
| Fluorouracil | Wikipedia |
| HMDB0014684 | HMDB |
| LSM-4261 | LINCS |
| URF | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:127172 | Reaxys |
| Beilstein:127172 | Beilstein |
| CAS:51-21-8 | ChemIDplus |
| CAS:51-21-8 | KEGG COMPOUND |
| Citations |
|---|