EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O2 |
| Net Charge | 0 |
| Average Mass | 168.236 |
| Monoisotopic Mass | 168.11503 |
| SMILES | CC1=C(O)C(=O)C(C(C)C)CC1 |
| InChI | InChI=1S/C10H16O2/c1-6(2)8-5-4-7(3)9(11)10(8)12/h6,8,11H,4-5H2,1-3H3 |
| InChIKey | QSIMLPCPCXVYDD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diosphenol (CHEBI:4632) has role plant metabolite (CHEBI:76924) |
| diosphenol (CHEBI:4632) is a cyclic monoterpene ketone (CHEBI:23446) |
| diosphenol (CHEBI:4632) is a enol (CHEBI:33823) |
| IUPAC Name |
|---|
| 2-hydroxy-3-methyl-6-(propan-2-yl)cyclohex-2-en-1-one |
| Synonyms | Source |
|---|---|
| 2-Hydroxy-6-isopropyl-3-methyl-2-cyclohexen-1-one | NIST Chemistry WebBook |
| 2-Hydroxypiperitone | ChemIDplus |
| Barosma camphor | NIST Chemistry WebBook |
| Buccocamphor | NIST Chemistry WebBook |
| Buchu camphor | NIST Chemistry WebBook |
| Diosphenol | KEGG COMPOUND |
| Citations |
|---|