EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28869 - menadione
| Formula | C11H8O2 |
| Net Charge | 0 |
| Average Mass | 172.183 |
| Monoisotopic Mass | 172.05243 |
| SMILES | CC1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H8O2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13/h2-6H,1H3 |
| InChIKey | MJVAVZPDRWSRRC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (15722567) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor that interferes with the action of SARS coronavirus main proteinase (EC 3.4.22.69). human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| Applications: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| menadione (CHEBI:28869) has role angiogenesis inhibitor (CHEBI:48422) |
| menadione (CHEBI:28869) has role antineoplastic agent (CHEBI:35610) |
| menadione (CHEBI:28869) has role EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor (CHEBI:147285) |
| menadione (CHEBI:28869) has role human urinary metabolite (CHEBI:84087) |
| menadione (CHEBI:28869) has role nutraceutical (CHEBI:50733) |
| menadione (CHEBI:28869) is a 1,4-naphthoquinones (CHEBI:132142) |
| menadione (CHEBI:28869) is a vitamin K (CHEBI:28384) |
| Incoming Relation(s) |
| menadione sodium sulfonate (CHEBI:63928) has functional parent menadione (CHEBI:28869) |
| menadione sulfonic acid (CHEBI:63930) has functional parent menadione (CHEBI:28869) |
| IUPAC Name |
|---|
| 2-methylnaphthalene-1,4-dione |
| Synonyms | Source |
|---|---|
| 2-methyl-1,4-naphthalenedione | ChemIDplus |
| 2-Methyl-1,4-naphthochinon | ChemIDplus |
| 2-methyl-1,4-naphthoquinone | KEGG COMPOUND |
| 2-methylnaphthoquinone | ChemIDplus |
| 3-methyl-1,4-naphthoquinone | ChemIDplus |
| menadion | ChemIDplus |
| Brand Names | Source |
|---|---|
| Aquakay | ChemIDplus |
| Aquinone | ChemIDplus |
| Hemodal | ChemIDplus |
| Kappaxin | KEGG DRUG |
| UniProt Name | Source |
|---|---|
| menadione | UniProt |
| Citations |
|---|