EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8O2 |
| Net Charge | 0 |
| Average Mass | 172.183 |
| Monoisotopic Mass | 172.05243 |
| SMILES | CC1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H8O2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13/h2-6H,1H3 |
| InChIKey | MJVAVZPDRWSRRC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (15722567) |
| Roles Classification |
|---|
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor that interferes with the action of SARS coronavirus main proteinase (EC 3.4.22.69). fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| menadione (CHEBI:28869) has role angiogenesis inhibitor (CHEBI:48422) |
| menadione (CHEBI:28869) has role antineoplastic agent (CHEBI:35610) |
| menadione (CHEBI:28869) has role EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor (CHEBI:147285) |
| menadione (CHEBI:28869) has role human urinary metabolite (CHEBI:84087) |
| menadione (CHEBI:28869) has role nutraceutical (CHEBI:50733) |
| menadione (CHEBI:28869) is a 1,4-naphthoquinones (CHEBI:132142) |
| menadione (CHEBI:28869) is a vitamin K (CHEBI:28384) |
| Incoming Relation(s) |
| menadione sodium sulfonate (CHEBI:63928) has functional parent menadione (CHEBI:28869) |
| menadione sulfonic acid (CHEBI:63930) has functional parent menadione (CHEBI:28869) |
| IUPAC Name |
|---|
| 2-methylnaphthalene-1,4-dione |
| Synonyms | Source |
|---|---|
| 2-methyl-1,4-naphthalenedione | ChemIDplus |
| 2-Methyl-1,4-naphthochinon | ChemIDplus |
| 2-methyl-1,4-naphthoquinone | KEGG COMPOUND |
| 2-methylnaphthoquinone | ChemIDplus |
| 3-methyl-1,4-naphthoquinone | ChemIDplus |
| menadion | ChemIDplus |
| Brand Names | Source |
|---|---|
| Aquakay | ChemIDplus |
| Aquinone | ChemIDplus |
| Hemodal | ChemIDplus |
| Kappaxin | KEGG DRUG |
| UniProt Name | Source |
|---|---|
| menadione | UniProt |
| Citations |
|---|