EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32N6O4S |
| Net Charge | 0 |
| Average Mass | 488.614 |
| Monoisotopic Mass | 488.22057 |
| SMILES | CCCc1nc(C)c2c(=O)nc(-c3cc(S(=O)(=O)N4CCN(CC)CC4)ccc3OCC)nn12 |
| InChI | InChI=1S/C23H32N6O4S/c1-5-8-20-24-16(4)21-23(30)25-22(26-29(20)21)18-15-17(9-10-19(18)33-7-3)34(31,32)28-13-11-27(6-2)12-14-28/h9-10,15H,5-8,11-14H2,1-4H3,(H,25,26,30) |
| InChIKey | SECKRCOLJRRGGV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 3.1.4.* (phosphoric diester hydrolase) inhibitor An EC 3.1.* (ester hydrolase) inhibitor that interferes with the action of a phosphoric diester hydrolase (EC 3.1.4.*). |
| Application: | vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vardenafil (CHEBI:46295) has role EC 3.1.4.* (phosphoric diester hydrolase) inhibitor (CHEBI:50218) |
| vardenafil (CHEBI:46295) has role vasodilator agent (CHEBI:35620) |
| vardenafil (CHEBI:46295) is a N-alkylpiperazine (CHEBI:46845) |
| vardenafil (CHEBI:46295) is a N-sulfonylpiperazine (CHEBI:46918) |
| vardenafil (CHEBI:46295) is a imidazotriazine (CHEBI:46906) |
| IUPAC Name |
|---|
| 2-{2-ethoxy-5-[(4-ethylpiperazin-1-yl)sulfonyl]phenyl}-5-methyl-7-propylimidazo[5,1-f][1,2,4]triazin-4(1H)-one |
| Synonym | Source |
|---|---|
| 2-{2-ETHOXY-5-[(4-ETHYLPIPERAZIN-1-YL)SULFONYL]PHENYL}-5-METHYL-7-PROPYLIMIDAZO[5,1-F][1,2,4]TRIAZIN-4(1H)-ONE | PDBeChem |
| Brand Name | Source |
|---|---|
| Levitra | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9967331 | Reaxys |
| CAS:224785-90-4 | ChemIDplus |
| Citations |
|---|