EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8N2S |
| Net Charge | 0 |
| Average Mass | 152.222 |
| Monoisotopic Mass | 152.04082 |
| SMILES | NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C7H8N2S/c8-7(10)9-6-4-2-1-3-5-6/h1-5H,(H3,8,9,10) |
| InChIKey | FULZLIGZKMKICU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 1.14.18.1 (tyrosinase) inhibitor Any EC 1.14.18.* (oxidoreductase acting on paired donors, miscellaneous compound as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosinase (monophenol monooxygenase), EC 1.14.18.1, an enzyme that catalyses the oxidation of phenols (such as tyrosine) and is widespread in plants and animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-phenylthiourea (CHEBI:46261) has functional parent thiourea (CHEBI:36946) |
| N-phenylthiourea (CHEBI:46261) has role EC 1.14.18.1 (tyrosinase) inhibitor (CHEBI:59997) |
| N-phenylthiourea (CHEBI:46261) is a thioureas (CHEBI:51276) |
| IUPAC Name |
|---|
| 1-phenylthiourea |
| Synonyms | Source |
|---|---|
| 1-phenyl-2-thiourea | ChemIDplus |
| monophenyl thiourea | ChEBI |
| phenyl-2-thiourea | NIST Chemistry WebBook |
| phenylthiocarbamide | ChemIDplus |
| phenylthiourea | ChemIDplus |
| PhNHC(=S)NH2 | ChEBI |
| Citations |
|---|