EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H38N2O6 |
| Net Charge | 0 |
| Average Mass | 558.675 |
| Monoisotopic Mass | 558.27299 |
| SMILES | [H][C@](c1cccc(NC(=O)CCNC(=O)OC(C)(C)C)c1)(c1c(O)cc([C@H](CC)Cc2ccccc2)oc1=O)C1C=C1 |
| InChI | InChI=1S/C33H38N2O6/c1-5-22(18-21-10-7-6-8-11-21)27-20-26(36)30(31(38)40-27)29(23-14-15-23)24-12-9-13-25(19-24)35-28(37)16-17-34-32(39)41-33(2,3)4/h6-15,19-20,22-23,29,36H,5,16-18H2,1-4H3,(H,34,39)(H,35,37)/t22-,29+/m1/s1 |
| InChIKey | OORLDLMDGJZAFM-MNNSJKJDSA-N |
| Roles Classification |
|---|
| Biological Role: | HIV protease inhibitor An inhibitor of HIV protease, an enzyme required for production of proteins needed for viral assembly. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| U100313 (CHEBI:46238) has role HIV protease inhibitor (CHEBI:35660) |
| U100313 (CHEBI:46238) is a 2-pyranones (CHEBI:75885) |
| U100313 (CHEBI:46238) is a anilide (CHEBI:13248) |
| U100313 (CHEBI:46238) is a carbamate ester (CHEBI:23003) |
| U100313 (CHEBI:46238) is a cyclopropenes (CHEBI:51455) |
| U100313 (CHEBI:46238) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| tert-butyl [3-({3-[(S)-cycloprop-2-en-1-yl{4-hydroxy-2-oxo-6-[(2R)-1-phenylbutan-2-yl]-2H-pyran-3-yl}methyl]phenyl}amino)-3-oxopropyl]carbamate |
| Synonym | Source |
|---|---|
| tert-butyl [3-({3-[(S)-{6-[(1R)-1-benzylpropyl]-4-hydroxy-2-oxo-2H-pyran-3-yl}(cycloprop-2-en-1-yl)methyl]phenyl}amino)-3-oxopropyl]carbamate | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| U02 | PDBeChem |
| Citations |
|---|