EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO6S |
| Net Charge | 0 |
| Average Mass | 261.255 |
| Monoisotopic Mass | 261.03071 |
| SMILES | N[C@@H](Cc1ccc(OS(=O)(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C9H11NO6S/c10-8(9(11)12)5-6-1-3-7(4-2-6)16-17(13,14)15/h1-4,8H,5,10H2,(H,11,12)(H,13,14,15)/t8-/m0/s1 |
| InChIKey | CIQHWLTYGMYQQR-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (26449609) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O4'-sulfo-L-tyrosine (CHEBI:46215) has role human metabolite (CHEBI:77746) |
| O4'-sulfo-L-tyrosine (CHEBI:46215) is a O-sulfoamino acid (CHEBI:37862) |
| O4'-sulfo-L-tyrosine (CHEBI:46215) is a L-tyrosine derivative (CHEBI:27177) |
| O4'-sulfo-L-tyrosine (CHEBI:46215) is a aryl sulfate (CHEBI:37919) |
| O4'-sulfo-L-tyrosine (CHEBI:46215) is conjugate acid of O4'-sulfo-L-tyrosinate(1−) (CHEBI:133573) |
| Incoming Relation(s) |
| O4'-sulfo-L-tyrosinate(1−) (CHEBI:133573) is conjugate base of O4'-sulfo-L-tyrosine (CHEBI:46215) |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-[4-(sulfooxy)phenyl]propanoic acid | IUPAC |
| (2S)-2-azanyl-3-(4-sulfooxyphenyl)propanoic acid | PDBeChem |
| L-Tyrosine O-sulfate | ChemIDplus |
| O-sulfo-L-tyrosine | PDBeChem |
| Sulfotyrosine | ChemIDplus |
| Tyrosine O-sulfate | ChemIDplus |
| Citations |
|---|